cas: 1187929-87-8 — see every product listed under this CAS number, including other names
5,6,7,8-Tetrahydroquinolin-8-amine dihydrochloride, 95%, 95% (CAS 1187929-87-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1102RS-100mg |
| cas | 1187929-87-8 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 731.60 Pln | |
| Chemat | 5g | 2402.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride (CAS 1187929-87-8) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride. InChIKey: DTETYNWEDVEEFT-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride |
| InChIKey | DTETYNWEDVEEFT-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)