5,6-Dibromoisoindoline-1,3-dione, 95%
cas: 247045-28-9 — see every product listed under this CAS number, including other names
5,6-Dibromoisoindoline-1,3-dione, 95% (CAS 247045-28-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QN-3116-1g |
| cas | 247045-28-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 3852.50 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1144.40 Pln | |
| Chemat | 5g | 3304.40 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1469.51 Pln | |
| BLDpharm | 5g | 4151.90 Pln | |
| Fluorochem | 100mg | 617.51 Pln | |
| Fluorochem | 250mg | 929.90 Pln | |
| Fluorochem | 1g | 2116.98 Pln | |
| Fluorochem | 5g | 6136.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5,6-dibromoisoindole-1,3-dione (CAS 247045-28-9) is a chemical compound with the molecular formula C8H3Br2NO2 and a molecular weight of 304.92 g/mol. IUPAC name: 5,6-dibromoisoindole-1,3-dione. InChIKey: UHWYUWWFPSLKRN-UHFFFAOYSA-N.
| Molecular formula | C8H3Br2NO2 |
|---|---|
| Molecular weight | 304.92 g/mol |
| IUPAC name | 5,6-dibromoisoindole-1,3-dione |
| InChIKey | UHWYUWWFPSLKRN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)C(=O)NC2=O |
Computed by PubChem (NCBI)