CAS 17826-05-0 appears in our catalog under these names: 5,6-Dibromoindoline-2,3-dione, 95%, 5,6–Dibromoindoline–2,3–dione, 5,6-Dibromoindoline-2,3-dione, 5,6-Dibromoindoline-2,3-dione 95%, 5,6-Dibromoindoline-2,3-dione, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg, 2,5g.
5,6-dibromo-1H-indole-2,3-dione (CAS 17826-05-0) is a chemical compound with the molecular formula C8H3Br2NO2 and a molecular weight of 304.92 g/mol. IUPAC name: 5,6-dibromo-1H-indole-2,3-dione. InChIKey: BHIYOAMJNNOSLP-UHFFFAOYSA-N.
| Molecular formula | C8H3Br2NO2 |
|---|---|
| Molecular weight | 304.92 g/mol |
| IUPAC name | 5,6-dibromo-1H-indole-2,3-dione |
| InChIKey | BHIYOAMJNNOSLP-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)NC(=O)C2=O |
Computed by PubChem (NCBI)