CAS 20780-89-6 appears in our catalog under these names: 4,7-Dibromo-2,3-dihydro-1H-indole-2,3-dione, 95%, 4,7-Dibromo-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4,7-dibromo-1H-indole-2,3-dione (CAS 20780-89-6) is a chemical compound with the molecular formula C8H3Br2NO2 and a molecular weight of 304.92 g/mol. IUPAC name: 4,7-dibromo-1H-indole-2,3-dione. InChIKey: JYLCBTSWCOVUIR-UHFFFAOYSA-N.
| Molecular formula | C8H3Br2NO2 |
|---|---|
| Molecular weight | 304.92 g/mol |
| IUPAC name | 4,7-dibromo-1H-indole-2,3-dione |
| InChIKey | JYLCBTSWCOVUIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)C(=O)C(=O)N2)Br |
Computed by PubChem (NCBI)