CAS 187326-67-6 appears in our catalog under these names: 4,6-Dibromoindoline-2,3-dione, 95%, 4,6-Dibromoindoline-2,3-dione, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4,6-dibromo-1H-indole-2,3-dione (CAS 187326-67-6) is a chemical compound with the molecular formula C8H3Br2NO2 and a molecular weight of 304.92 g/mol. IUPAC name: 4,6-dibromo-1H-indole-2,3-dione. InChIKey: UGFPBMXSBFXNBX-UHFFFAOYSA-N.
| Molecular formula | C8H3Br2NO2 |
|---|---|
| Molecular weight | 304.92 g/mol |
| IUPAC name | 4,6-dibromo-1H-indole-2,3-dione |
| InChIKey | UGFPBMXSBFXNBX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C2=O)Br)Br |
Computed by PubChem (NCBI)