cas: 176244-21-6 — see every product listed under this CAS number, including other names
5,6-Difluoro-1,3-dihydro-2H-benzimidazol-2-one, 97%, 97% (CAS 176244-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11B2CE-100mg |
| cas | 176244-21-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 554.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,6-difluoro-1,3-dihydrobenzimidazol-2-one (CAS 176244-21-6) is a chemical compound with the molecular formula C7H4F2N2O and a molecular weight of 170.12 g/mol. IUPAC name: 5,6-difluoro-1,3-dihydrobenzimidazol-2-one. InChIKey: FNIZLMLIRWCFRX-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 5,6-difluoro-1,3-dihydrobenzimidazol-2-one |
| InChIKey | FNIZLMLIRWCFRX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC(=O)N2 |
Computed by PubChem (NCBI)