CAS 1535357-52-8 is the registry number for 6,7-Difluoro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6,7-difluoro-1,3-benzoxazol-2-amine (CAS 1535357-52-8) is a chemical compound with the molecular formula C7H4F2N2O and a molecular weight of 170.12 g/mol. IUPAC name: 6,7-difluoro-1,3-benzoxazol-2-amine. InChIKey: WZBXVWGBYIJIBC-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 6,7-difluoro-1,3-benzoxazol-2-amine |
| InChIKey | WZBXVWGBYIJIBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(O2)N)F)F |
Computed by PubChem (NCBI)