CAS 1936532-36-3 is the registry number for 5,7-Difluorobenzo[d]isoxazol-3-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-difluoro-1,2-benzoxazol-3-amine (CAS 1936532-36-3) is a chemical compound with the molecular formula C7H4F2N2O and a molecular weight of 170.12 g/mol. IUPAC name: 5,7-difluoro-1,2-benzoxazol-3-amine. InChIKey: IMXJMUNGNAZPRH-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 5,7-difluoro-1,2-benzoxazol-3-amine |
| InChIKey | IMXJMUNGNAZPRH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NO2)N)F)F |
Computed by PubChem (NCBI)