Products 1339452-03-7
CAS 1339452-03-7 appears in our catalog under these names: 4,6-Difluoro-1,3-benzoxazol-2-amine, 96%, 4,6-Difluorobenzo(d)oxazol-2-amine, 96%, 4,6-Difluoro-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4,6-difluoro-1,3-benzoxazol-2-amine (CAS 1339452-03-7) is a chemical compound with the molecular formula C7H4F2N2O and a molecular weight of 170.12 g/mol. IUPAC name: 4,6-difluoro-1,3-benzoxazol-2-amine. InChIKey: GRUJYULCYAYSAF-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 4,6-difluoro-1,3-benzoxazol-2-amine |
| InChIKey | GRUJYULCYAYSAF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC(=N2)N)F)F |
Computed by PubChem (NCBI)