Products 88210-96-2
CAS 88210-96-2 appears in our catalog under these names: 5,6-Dimethoxyindole-2-carboxylic acid, 98% , 5,6-Dimethoxyindole-2-carboxylic acid 95%, 5,6-Dimethoxy-1H-indole-2-carboxylic acid, 95%, 5,6-Dimethoxy-1H-indole-2-carboxylic acid, 98%, 98%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 100mg.
5,6-dimethoxy-1H-indole-2-carboxylic acid (CAS 88210-96-2) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 5,6-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: UZHQHNDRVITJPL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 5,6-dimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | UZHQHNDRVITJPL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(N2)C(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
5,6-Dica, 5,6-Dimethoyxindole-2-carboxylic acid, 1H-Indole-2-carboxylic acid, 5,6-dimethoxy-, 5,6-Dimethoxyindolyl-2-carboxylic acid, 5,6-dimethoxy-1H-indole-2-carboxylic acid, 5,6-Dimethoxyindole-2-carboxylic acid, ?5,6-Dimethoxyindole-2-carboxylic acid, 5,6-Dimethoxyindole-2-carboxylic acid, AldrichCPR