cas: 18591-57-6 — see every product listed under this CAS number, including other names
5,6-Diphenylpyrazin-2-ol 97% (CAS 18591-57-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A177346-1g |
| cas | 18591-57-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1193.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A177346 |
5,6-diphenyl-1H-pyrazin-2-one (CAS 18591-57-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 5,6-diphenyl-1H-pyrazin-2-one. InChIKey: LTWBZUZTTUVPIM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 5,6-diphenyl-1H-pyrazin-2-one |
| InChIKey | LTWBZUZTTUVPIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)