cas: 18591-57-6 — see every product listed under this CAS number, including other names
5,6-Diphenylpyrazin-2-ol, 98% (CAS 18591-57-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F432110-10G |
| cas | 18591-57-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 320.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,6-diphenyl-1H-pyrazin-2-one (CAS 18591-57-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 5,6-diphenyl-1H-pyrazin-2-one. InChIKey: LTWBZUZTTUVPIM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 5,6-diphenyl-1H-pyrazin-2-one |
| InChIKey | LTWBZUZTTUVPIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)