cas: 189102-97-4 — see every product listed under this CAS number, including other names
5,6-dichloro-1H-imidazo[4,5-b]pyridine, 97% (CAS 189102-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F718603-100MG |
| cas | 189102-97-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2361.69 Pln | |
| Fluorochem | 5g | 6922.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5,6-dichloro-1H-imidazo[4,5-b]pyridine (CAS 189102-97-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 5,6-dichloro-1H-imidazo[4,5-b]pyridine. InChIKey: UWYSZYFNTMSWDF-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 5,6-dichloro-1H-imidazo[4,5-b]pyridine |
| InChIKey | UWYSZYFNTMSWDF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)N=CN2 |
Computed by PubChem (NCBI)