cas: 189102-97-4 — see every product listed under this CAS number, including other names
5,6-dichloro-3H-iMidazo[4,5-b]pyridine, 97%, 97% (CAS 189102-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113HVV-100mg |
| cas | 189102-97-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 4197.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,6-dichloro-1H-imidazo[4,5-b]pyridine (CAS 189102-97-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 5,6-dichloro-1H-imidazo[4,5-b]pyridine. InChIKey: UWYSZYFNTMSWDF-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 5,6-dichloro-1H-imidazo[4,5-b]pyridine |
| InChIKey | UWYSZYFNTMSWDF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)N=CN2 |
Computed by PubChem (NCBI)