cas: 50477-28-6 — see every product listed under this CAS number, including other names
5,7-DIBROMO-1H-INDAZOLE, 98% (CAS 50477-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F858735-100MG |
| cas | 50477-28-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 601.89 Pln | |
| Fluorochem | 5g | 2002.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,7-dibromo-1H-indazole (CAS 50477-28-6) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 5,7-dibromo-1H-indazole. InChIKey: SBDPXXDRYPLLKE-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 5,7-dibromo-1H-indazole |
| InChIKey | SBDPXXDRYPLLKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)Br)Br |
Computed by PubChem (NCBI)