cas: 50477-28-6 — see every product listed under this CAS number, including other names
5,7-Dibromo-1H-indazole 95% (CAS 50477-28-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485619-250mg |
| cas | 50477-28-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1772.12 Pln | |
| Ambeed | 10g | 2350.62 Pln | |
| Ambeed | 25g | 4992.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A485619 |
5,7-dibromo-1H-indazole (CAS 50477-28-6) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 5,7-dibromo-1H-indazole. InChIKey: SBDPXXDRYPLLKE-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 5,7-dibromo-1H-indazole |
| InChIKey | SBDPXXDRYPLLKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)Br)Br |
Computed by PubChem (NCBI)