5,7-Dichloro-2-methylpyrazolo[1,5-a]pyrimidine 98%
cas: 754211-02-4 — see every product listed under this CAS number, including other names
5,7-Dichloro-2-methylpyrazolo[1,5-a]pyrimidine 98% (CAS 754211-02-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A297478-100mg |
| cas | 754211-02-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 2005.75 Pln | |
| Ambeed | 10g | 3179.44 Pln | |
| Ambeed | 25g | 6105.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A297478 |
5,7-dichloro-2-methylpyrazolo[1,5-a]pyrimidine (CAS 754211-02-4) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 5,7-dichloro-2-methylpyrazolo[1,5-a]pyrimidine. InChIKey: GVBFQCRXNZJBFB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 5,7-dichloro-2-methylpyrazolo[1,5-a]pyrimidine |
| InChIKey | GVBFQCRXNZJBFB-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)