cas: 754211-02-4 — see every product listed under this CAS number, including other names
5,7-Dichloro-2-methylpyrazolo[1,5-a]pyrimidine, 98%, 98% (CAS 754211-02-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G82H-100mg |
| cas | 754211-02-4 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1466.00 Pln | |
| Chemat | 10g | 2459.60 Pln | |
| Chemat | 25g | 4955.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-2-methylpyrazolo[1,5-a]pyrimidine (CAS 754211-02-4) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 5,7-dichloro-2-methylpyrazolo[1,5-a]pyrimidine. InChIKey: GVBFQCRXNZJBFB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 5,7-dichloro-2-methylpyrazolo[1,5-a]pyrimidine |
| InChIKey | GVBFQCRXNZJBFB-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)