cas: 1934666-20-2 — see every product listed under this CAS number, including other names
5,7-Dichloro-3-iodo-1H-pyrazolo[3,4-c]pyridine, 97% (CAS 1934666-20-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A883712-100mg |
| cas | 1934666-20-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1149.12 Pln | |
| Ambeed | 250mg | 1861.13 Pln | |
| Ambeed | 1g | 4558.94 Pln | |
| BLDpharm | 100mg | 1236.26 Pln | |
| BLDpharm | 250mg | 2002.65 Pln | |
| BLDpharm | 1g | 4907.19 Pln | |
| Chemat | 100mg | 880.40 Pln | |
| Chemat | 250mg | 1422.80 Pln | |
| Chemat | 1g | 3467.60 Pln | |
| Fluorochem | 100mg | 1117.33 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 1g | 4397.43 Pln | |
| Fluorochem | 5g | 12831.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5,7-dichloro-3-iodo-2H-pyrazolo[3,4-c]pyridine (CAS 1934666-20-2) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 5,7-dichloro-3-iodo-2H-pyrazolo[3,4-c]pyridine. InChIKey: QGTZDOPYMSODBC-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2IN3 |
|---|---|
| Molecular weight | 313.91 g/mol |
| IUPAC name | 5,7-dichloro-3-iodo-2H-pyrazolo[3,4-c]pyridine |
| InChIKey | QGTZDOPYMSODBC-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C2=NNC(=C21)I)Cl)Cl |
Computed by PubChem (NCBI)