5,7-Dichloro-3-iodopyrazolo[1,5-a]pyrimidine, 98%
cas: 754211-05-7 — see every product listed under this CAS number, including other names
5,7-Dichloro-3-iodopyrazolo[1,5-a]pyrimidine, 98% (CAS 754211-05-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A754259-250mg |
| cas | 754211-05-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 2028.00 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 2180.37 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5,7-dichloro-3-iodopyrazolo[1,5-a]pyrimidine (CAS 754211-05-7) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 5,7-dichloro-3-iodopyrazolo[1,5-a]pyrimidine. InChIKey: RJTIQNFZPDTAMI-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2IN3 |
|---|---|
| Molecular weight | 313.91 g/mol |
| IUPAC name | 5,7-dichloro-3-iodopyrazolo[1,5-a]pyrimidine |
| InChIKey | RJTIQNFZPDTAMI-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C(C=N2)I)N=C1Cl)Cl |
Computed by PubChem (NCBI)
![5,7-Dichloro-3-iodopyrazolo[1,5-a]pyrimidine, 96%](https://cdn.chemat.com.pl/products/images/2a9d705b9366a7eb1a0f7b2a97726d328fc7ec0568b32a3f1f2e4028d9745ac9.svg)