cas: 247564-59-6 — see every product listed under this CAS number, including other names
5,7-Difluoroindolin-2-one, 98%, 98% (CAS 247564-59-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PB3-100mg |
| cas | 247564-59-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1811.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,7-difluoro-1,3-dihydroindol-2-one (CAS 247564-59-6) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 5,7-difluoro-1,3-dihydroindol-2-one. InChIKey: SHPZWXNWJLWGQK-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5,7-difluoro-1,3-dihydroindol-2-one |
| InChIKey | SHPZWXNWJLWGQK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)F)NC1=O |
Computed by PubChem (NCBI)