cas: 247564-59-6 — see every product listed under this CAS number, including other names
5,7-Difluoroindolin-2-one, 97% (CAS 247564-59-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A749785-25g |
| cas | 247564-59-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 12152.56 Pln | |
| AmBeed | 250mg | 1085.56 Pln | |
| AmBeed | 10g | 6111.28 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-difluoro-1,3-dihydroindol-2-one (CAS 247564-59-6) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 5,7-difluoro-1,3-dihydroindol-2-one. InChIKey: SHPZWXNWJLWGQK-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5,7-difluoro-1,3-dihydroindol-2-one |
| InChIKey | SHPZWXNWJLWGQK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)F)NC1=O |
Computed by PubChem (NCBI)