5,7-Difluoro-1,3-dihydroindol-2-one, 90%
cas: 247564-59-6 — see every product listed under this CAS number, including other names
5,7-Difluoro-1,3-dihydroindol-2-one, 90% (CAS 247564-59-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010572-250MG |
| cas | 247564-59-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 2205.49 Pln | |
| Fluorochem | 10g | 3814.30 Pln | |
| Fluorochem | 25g | 7948.26 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 3-4 weeks |
5,7-difluoro-1,3-dihydroindol-2-one (CAS 247564-59-6) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 5,7-difluoro-1,3-dihydroindol-2-one. InChIKey: SHPZWXNWJLWGQK-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5,7-difluoro-1,3-dihydroindol-2-one |
| InChIKey | SHPZWXNWJLWGQK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)F)NC1=O |
Computed by PubChem (NCBI)
Synonyms:
5,7-difluoro-1,3-dihydro-2H-indol-2-one, 5,7-difluoroindolin-2-one, 5,7-difluoro-1,3-dihydroindol-2-one, 5,7-difluoro-2,3-dihydro-1H-indol-2-one, 5,7-difluorooxindole, 5,7-difluoro-2-oxyindole, 2H-Indol-2-one, 5,7-difluoro-1,3-dihydro-, 5,7-difluoro-2-oxindole, 5,7-Difluoro-, SHPZWXNWJLWGQK-UHFFFAOYSA-N