CAS 247564-59-6 appears in our catalog under these names: 5,7-Difluoro-1,3-dihydro-2h-indol-2-one, 97%, 5,7-Difluoroindolin-2-one, 97%, 5,7–Difluoroindolin–2–one, 5,7-Difluoroindolin-2-one, 98%, 98%, 5,7-Difluoro-1,3-dihydroindol-2-one, 90%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 250mg, 10g, 100mg, 5g.
5,7-difluoro-1,3-dihydroindol-2-one (CAS 247564-59-6) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 5,7-difluoro-1,3-dihydroindol-2-one. InChIKey: SHPZWXNWJLWGQK-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5,7-difluoro-1,3-dihydroindol-2-one |
| InChIKey | SHPZWXNWJLWGQK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)F)NC1=O |
Computed by PubChem (NCBI)