CAS 2137829-00-4 is the registry number for 3,​4-​dihydro-​2-​methyl-2H-​Pyrazolo(1,​5-​e)​-​1,​2,​5-​thiadiazine-​8-​carboxylic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylic acid (CAS 2137829-00-4) is a chemical compound with the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. IUPAC name: 2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylic acid. InChIKey: QUMFFNXIRZKNGC-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-3,4-dihydropyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylic acid |
| InChIKey | QUMFFNXIRZKNGC-UHFFFAOYSA-N |
| SMILES | CN1CCN2C(=C(C=N2)C(=O)O)S1(=O)=O |
Computed by PubChem (NCBI)