cas: 891782-63-1 — see every product listed under this CAS number, including other names
5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid, 97% (CAS 891782-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339960-100MG |
| cas | 891782-63-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 500mg | 721.64 Pln | |
| Fluorochem | 1g | 872.63 Pln | |
| Fluorochem | 5g | 4095.45 Pln | |
| Fluorochem | 10g | 6875.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid (CAS 891782-63-1) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid. InChIKey: MOLNWRVQKCBISZ-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid |
| InChIKey | MOLNWRVQKCBISZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(N=C1)C(=O)O |
Computed by PubChem (NCBI)