Products 1004727-34-7

CAS 1004727-34-7 is the registry number for 1-Methyl-3-(morpholine-4-carbonyl)-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 50mg, 250mg.

Structural formula: {0} (CAS {1})

1-methyl-3-(morpholine-4-carbonyl)pyrazole-5-carboxylic acid (CAS 1004727-34-7) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: 1-methyl-3-(morpholine-4-carbonyl)pyrazole-5-carboxylic acid. InChIKey: HLHCCAFKPMFFNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N3O4
Molecular weight239.23 g/mol
IUPAC name1-methyl-3-(morpholine-4-carbonyl)pyrazole-5-carboxylic acid
InChIKeyHLHCCAFKPMFFNQ-UHFFFAOYSA-N
SMILESCN1C(=CC(=N1)C(=O)N2CCOCC2)C(=O)O

Computed by PubChem (NCBI)