cas: 86864-59-7 — see every product listed under this CAS number, including other names
5-((tert-Butyldimethylsilyl)oxy)pentan-2-one 95% (CAS 86864-59-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A964956-1g |
| cas | 86864-59-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 681.88 Pln | |
| Ambeed | 5g | 1911.19 Pln | |
| Ambeed | 25g | 5604.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A964956 |
5-[tert-butyl(dimethyl)silyl]oxypentan-2-one (CAS 86864-59-7) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: 5-[tert-butyl(dimethyl)silyl]oxypentan-2-one. InChIKey: HYMOZAQHSDGTIS-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | 5-[tert-butyl(dimethyl)silyl]oxypentan-2-one |
| InChIKey | HYMOZAQHSDGTIS-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)