Products 2004718-99-2

CAS 2004718-99-2 is the registry number for 5-(2,5-Difluorophenyl)-1,3-oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(2,5-difluorophenyl)-1,3-oxazole (CAS 2004718-99-2) is a chemical compound with the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. IUPAC name: 5-(2,5-difluorophenyl)-1,3-oxazole. InChIKey: PBXCUZNWELCNAH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F2NO
Molecular weight181.14 g/mol
IUPAC name5-(2,5-difluorophenyl)-1,3-oxazole
InChIKeyPBXCUZNWELCNAH-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C2=CN=CO2)F

Computed by PubChem (NCBI)