CAS 328270-70-8 appears in our catalog under these names: 5-(2-Bromophenyl)-1,3-oxazole, 96%, 5–(2–Bromophenyl)oxazole, 5-(2-Bromophenyl)-1,3-oxazole, 5-(2-Bromophenyl)-1,3-oxazole, 95% , 5-(2-Bromophenyl)oxazole, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250MG.
5-(2-bromophenyl)-1,3-oxazole (CAS 328270-70-8) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-(2-bromophenyl)-1,3-oxazole. InChIKey: JLTHLCLAPCIKJJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,3-oxazole |
| InChIKey | JLTHLCLAPCIKJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=CO2)Br |
Computed by PubChem (NCBI)