cas: 368870-05-7 — see every product listed under this CAS number, including other names
5-(2-Methyl-1,3-thiazol-4-yl)-3-isoxazolecarboxylic acid, 97% (CAS 368870-05-7) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC14001CB |
| cas | 368870-05-7 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 855.25 Pln | |
| Thermo Scientific | 1g | 2484.31 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-3-carboxylic acid (CAS 368870-05-7) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: QAXQRHWAJNDTCV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | QAXQRHWAJNDTCV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)