CAS 1239311-42-2 appears in our catalog under these names: 5-(3,5-Difluorobenzyl)-1,3,4-thiadiazol-2-amine, 98%, 5-(3,5-Difluorobenzyl)-1,3,4-thiadiazol-2-amine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 1239311-42-2) is a chemical compound with the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. IUPAC name: 5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: OCWLFDMIHBVMFF-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | OCWLFDMIHBVMFF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)