CAS 886495-11-0 is the registry number for 4-(3,4-Difluorophenyl)-2-hydrazinylthiazole, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]hydrazine (CAS 886495-11-0) is a chemical compound with the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. IUPAC name: [4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]hydrazine. InChIKey: DUMMXEBJADHKQP-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | [4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]hydrazine |
| InChIKey | DUMMXEBJADHKQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CSC(=N2)NN)F)F |
Computed by PubChem (NCBI)