CAS 400742-04-3 is the registry number for 5-(2,3-Difluorobenzyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2,3-difluorophenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 400742-04-3) is a chemical compound with the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. IUPAC name: 5-[(2,3-difluorophenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: IFXJHNXHRXVSCQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 5-[(2,3-difluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | IFXJHNXHRXVSCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)