CAS 1340538-90-0 appears in our catalog under these names: 3-((2,4-Difluorophenyl)methyl)-1,2,4-thiadiazol-5-amine, 95%, 3-((2,4-Difluorophenyl)methyl)-1,2,4-thiadiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine (CAS 1340538-90-0) is a chemical compound with the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. IUPAC name: 3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine. InChIKey: YSUPWJLXNRFWDI-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine |
| InChIKey | YSUPWJLXNRFWDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC2=NSC(=N2)N |
Computed by PubChem (NCBI)