cas: 1147417-27-3 — see every product listed under this CAS number, including other names
5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid, 95%+, 95%+ (CAS 1147417-27-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCWK-1g |
| cas | 1147417-27-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1715.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
3-(3-methoxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 1147417-27-3) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 3-(3-methoxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: IEQRHIQFNLEJMF-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | IEQRHIQFNLEJMF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)