cas: 250726-93-3 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-(1,3,2)dioxaborolan-2-yl)-2,3-dihydrothieno(3,4-b)(1,4)dioxine, 95-<97% (CAS 250726-93-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC189-95-97-10g |
| cas | 250726-93-3 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 4308.26 Pln | |
| Hoffman Fine Chemicals | 25g | 9456.92 Pln | |
| Hoffman Fine Chemicals | 50g | 14943.72 Pln | |
| Hoffman Fine Chemicals | 100g | 29113.70 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (CAS 250726-93-3) is a chemical compound with the molecular formula C12H17BO4S and a molecular weight of 268.14 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine. InChIKey: HRLHWIMNIQOHRF-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| InChIKey | HRLHWIMNIQOHRF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CS2)OCCO3 |
Computed by PubChem (NCBI)