CAS 709648-80-6 appears in our catalog under these names: (5-(Methoxycarbonyl)thiophen-3-yl)boronic acid pinacol ester, 95-<97%, (5-(Methoxycarbonyl)thiophen-3-yl)boronic acid pinacol ester, ≥97-<99%, methyl4–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiophene–2–carboxylate, Methyl 4-(4, 4, 5, 5-tetramethyl-1, 3, 2-dioxaborolan-2-yl) thiophene-2-carboxylate, Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100mg, 1g, 250mg, 0,5g.
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 709648-80-6) is a chemical compound with the molecular formula C12H17BO4S and a molecular weight of 268.14 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: DEUIVNYKDSXHRP-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | DEUIVNYKDSXHRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)C(=O)OC |
Computed by PubChem (NCBI)