CAS 1227664-10-9 is the registry number for Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 1227664-10-9) is a chemical compound with the molecular formula C12H17BO4S and a molecular weight of 268.14 g/mol. IUPAC name: methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: SHYCRSYAELDCRW-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | SHYCRSYAELDCRW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C(=O)OC |
Computed by PubChem (NCBI)