Products 2626951-66-2
CAS 2626951-66-2 is the registry number for 5-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid (CAS 2626951-66-2) is a chemical compound with the molecular formula C12H17BO4S and a molecular weight of 268.14 g/mol. IUPAC name: 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid. InChIKey: ISJLAAPQBGYNRV-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid |
| InChIKey | ISJLAAPQBGYNRV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)