cas: 827614-64-2 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 97%, 97% (CAS 827614-64-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115Y5X-100mg |
| cas | 827614-64-2 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 50g | 832.40 Pln | |
| Chemat | 100g | 1576.40 Pln | |
| Chemat | 1kg | 9107.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 827614-64-2) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: YFTAUNOLAHRUIE-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | YFTAUNOLAHRUIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)