cas: 321724-19-0 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 97%, 97% (CAS 321724-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I74L-250mg |
| cas | 321724-19-0 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 515.60 Pln | |
| Chemat | 50g | 890.00 Pln | |
| Chemat | 100g | 1662.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 321724-19-0) is a chemical compound with the molecular formula C10H15BN2O2 and a molecular weight of 206.05 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: WSRGGSAGSUEJKQ-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O2 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | WSRGGSAGSUEJKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CN=C2 |
Computed by PubChem (NCBI)