cas: 321724-19-0 — see every product listed under this CAS number, including other names
Pyrimidine-5-boronic acid pinacol ester, 98.0% (CAS 321724-19-0) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 1 g, 50 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-42045-10 g |
| cas | 321724-19-0 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 524.03 Pln | |
| MedChemExpress | 25 g | 928.06 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 50 g | 1406.39 Pln | |
| MedChemExpress | 5 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 321724-19-0) is a chemical compound with the molecular formula C10H15BN2O2 and a molecular weight of 206.05 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: WSRGGSAGSUEJKQ-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O2 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | WSRGGSAGSUEJKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CN=C2 |
Computed by PubChem (NCBI)