5-(4-(tert-Butoxycarbonyl)piperazin-1-yl)picolinic acid, 98%
cas: 1354355-86-4 — see every product listed under this CAS number, including other names
5-(4-(tert-Butoxycarbonyl)piperazin-1-yl)picolinic acid, 98% (CAS 1354355-86-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A481453-100mg |
| cas | 1354355-86-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1965.20 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 825.29 Pln | |
| Fluorochem | 1g | 773.70 Pln | |
| Fluorochem | 5g | 2137.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-2-carboxylic acid (CAS 1354355-86-4) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-2-carboxylic acid. InChIKey: OGXKNNCKUUAGLT-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-2-carboxylic acid |
| InChIKey | OGXKNNCKUUAGLT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(4-(tert-Butoxycarbonyl)piperazin-1-yl)picolinic acid, 5-{4-[(tert-butoxy)carbonyl]piperazin-1-yl}pyridine-2-carboxylic acid, 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-2-carboxylic acid, OGXKNNCKUUAGLT-UHFFFAOYSA-N, 5-(4-Boc-piperazin-1-yl)picolinic Acid, 5-(4-Boc-piperazin-1-yl)pyridine-2-carboxylic acid, 5-(4-tert-butoxycarbonylpiperazin-1-yl)pyridine-2-carboxylic acid