CAS 740-63-6 appears in our catalog under these names: Hippuryl-Lys-OH, Hippuryl–Lys–OH, Bz-Gly-Lys (Hippuryl-Lysine). Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 5g, 0,1g.
(2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid (CAS 740-63-6) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: (2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid. InChIKey: LRCZLURYHGISRZ-LBPRGKRZSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2S)-6-amino-2-[(2-benzamidoacetyl)amino]hexanoic acid |
| InChIKey | LRCZLURYHGISRZ-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)