Products 942468-36-2
CAS 942468-36-2 is the registry number for tert-Butyl 2-nitro-4-(piperazin-1-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-nitro-4-piperazin-1-ylbenzoate (CAS 942468-36-2) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: tert-butyl 2-nitro-4-piperazin-1-ylbenzoate. InChIKey: CTKSXHSPHRLPJK-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | tert-butyl 2-nitro-4-piperazin-1-ylbenzoate |
| InChIKey | CTKSXHSPHRLPJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)N2CCNCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)