CAS 26400-33-9 appears in our catalog under these names: FA-Gly-Leu-NH2, FA–Gly–Leu–NH₂, FA-Gly-Leu-NH2, 99.51%. Offered by: Creative Peptides, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 1g, 250mg, 1000mg, 500mg, 2000mg, 100 mg.
(2S)-2-[[2-[3-(furan-2-yl)prop-2-enoylamino]acetyl]amino]-4-methylpentanamide (CAS 26400-33-9) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: (2S)-2-[[2-[3-(furan-2-yl)prop-2-enoylamino]acetyl]amino]-4-methylpentanamide. InChIKey: JRGRHYPAYAJGAF-LBPRGKRZSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2S)-2-[[2-[3-(furan-2-yl)prop-2-enoylamino]acetyl]amino]-4-methylpentanamide |
| InChIKey | JRGRHYPAYAJGAF-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N)NC(=O)CNC(=O)C=CC1=CC=CO1 |
Computed by PubChem (NCBI)