5-(4-(tert-Butyl)phenyl)-1,3,4-thiadiazol-2-amine, 95%
cas: 100987-04-0 — see every product listed under this CAS number, including other names
5-(4-(tert-Butyl)phenyl)-1,3,4-thiadiazol-2-amine, 95% (CAS 100987-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A402182-250mg |
| cas | 100987-04-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 442.69 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 10g | 469.86 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine (CAS 100987-04-0) is a chemical compound with the molecular formula C12H15N3S and a molecular weight of 233.33 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: WEVOCASZWAUYHD-UHFFFAOYSA-N.
| Molecular formula | C12H15N3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | WEVOCASZWAUYHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)
Synonyms:
5-(4-tert-Butylphenyl)-1,3,4-thiadiazol-2-amine, 5-(4-(tert-Butyl)phenyl)-1,3,4-thiadiazol-2-amine, 1,3,4-Thiadiazol-2-amine, 5-[4-(1,1-dimethylethyl)phenyl]-, 5-[4-(tert-butyl)phenyl]-1,3,4-thiadiazole-2-ylamine, CBMicro_022474, Oprea1_284217, Oprea1_565061, 5-(4-tert-Butyl-phenyl)-[1,3,4]thiadiazol-2-ylamine, REGID_for_CID_811160, WEVOCASZWAUYHD-UHFFFAOYSA-N