CAS 100987-04-0 appears in our catalog under these names: 5–(4–(tert–Butyl)phenyl)–1,3,4–thiadiazol–2–amine, 5-(4-(tert-Butyl)phenyl)-1,3,4-thiadiazol-2-amine 95%, 5-(4-(tert-Butyl)phenyl)-1,3,4-thiadiazol-2-amine, 95%, 95%, 5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine (CAS 100987-04-0) is a chemical compound with the molecular formula C12H15N3S and a molecular weight of 233.33 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: WEVOCASZWAUYHD-UHFFFAOYSA-N.
| Molecular formula | C12H15N3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | WEVOCASZWAUYHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)