CAS 1086385-86-5 appears in our catalog under these names: 5-(4-tert-Butylphenyl)-1,2,4-thiadiazol-3-amine, 95%, 5-(4-(tert-Butyl)phenyl)-1,2,4-thiadiazol-3-amine, 97%, 5-(4-(tert-Butyl)phenyl)-1,2,4-thiadiazol-3-amine, 96%, 96%, 5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-amine, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-amine (CAS 1086385-86-5) is a chemical compound with the molecular formula C12H15N3S and a molecular weight of 233.33 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-amine. InChIKey: KMTRRQKJAQTEEY-UHFFFAOYSA-N.
| Molecular formula | C12H15N3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-amine |
| InChIKey | KMTRRQKJAQTEEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC(=NS2)N |
Computed by PubChem (NCBI)